C16H21N3O2 — CID 25355318
(2S)-2-(3,5-dimethylanilino)-N-(5-methyl-1,2-oxazol-3-yl)butanamide (PubChem CID 25355318) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is (2S)-2-(3,5-dimethylanilino)-N-(5-methyl-1,2-oxazol-3-yl)butanamide.
| Compound Name | (2S)-2-(3,5-dimethylanilino)-N-(5-methyl-1,2-oxazol-3-yl)butanamide |
|---|---|
| PubChem CID | 25355318 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | (2S)-2-(3,5-dimethylanilino)-N-(5-methyl-1,2-oxazol-3-yl)butanamide |
| SMILES | CC[C@H](Nc1cc(C)cc(C)c1)C(=O)Nc1cc(C)on1 |
| InChI | InChI=1S/C16H21N3O2/c1-5-14(16(20)18-15-9-12(4)21-19-15)17-13-7-10(2)6-11(3)8-13/h6-9,14,17H,5H2,1-4H3,(H,18,19,20)/t14-/m0/s1 |
| InChIKey | IZHIXKNVLYFBJO-AWEZNQCLSA-N |
| XLogP | 3.43 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |