C17H20N4O4 — CID 167906758
2-[(E)-[2-(3,5-dimethylanilino)-2-oxoethylidene]amino]oxy-N-(5-methyl-1,2-oxazol-3-yl)propanamide (PubChem CID 167906758) has the molecular formula C17H20N4O4 and a molecular weight of 344.37 g/mol. Its IUPAC name is 2-[(E)-[2-(3,5-dimethylanilino)-2-oxoethylidene]amino]oxy-N-(5-methyl-1,2-oxazol-3-yl)propanamide.
| Compound Name | 2-[(E)-[2-(3,5-dimethylanilino)-2-oxoethylidene]amino]oxy-N-(5-methyl-1,2-oxazol-3-yl)propanamide |
|---|---|
| PubChem CID | 167906758 |
| Molecular Formula | C17H20N4O4 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | 2-[(E)-[2-(3,5-dimethylanilino)-2-oxoethylidene]amino]oxy-N-(5-methyl-1,2-oxazol-3-yl)propanamide |
| SMILES | Cc1cc(C)cc(NC(=O)/C=N/OC(C)C(=O)Nc2cc(C)on2)c1 |
| InChI | InChI=1S/C17H20N4O4/c1-10-5-11(2)7-14(6-10)19-16(22)9-18-25-13(4)17(23)20-15-8-12(3)24-21-15/h5-9,13H,1-4H3,(H,19,22)(H,20,21,23)/b18-9+ |
| InChIKey | OAIMGNMBUUUKLL-GIJQJNRQSA-N |
| XLogP | 2.57 |
| TPSA | 105.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|