C9H14N4O3 — CID 131961427
3-[(5-methyl-1,2-oxazol-3-yl)carbamoylamino]butanamide (PubChem CID 131961427) has the molecular formula C9H14N4O3 and a molecular weight of 226.24 g/mol. Its IUPAC name is 3-[(5-methyl-1,2-oxazol-3-yl)carbamoylamino]butanamide.
| Compound Name | 3-[(5-methyl-1,2-oxazol-3-yl)carbamoylamino]butanamide |
|---|---|
| PubChem CID | 131961427 |
| Molecular Formula | C9H14N4O3 |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 3-[(5-methyl-1,2-oxazol-3-yl)carbamoylamino]butanamide |
| SMILES | Cc1cc(NC(=O)NC(C)CC(N)=O)no1 |
| InChI | InChI=1S/C9H14N4O3/c1-5(3-7(10)14)11-9(15)12-8-4-6(2)16-13-8/h4-5H,3H2,1-2H3,(H2,10,14)(H2,11,12,13,15) |
| InChIKey | LCCZRTRDGUGNGI-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 110.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |