C10H15N3O2 — CID 47125586
1-(1-cyclopropylethyl)-3-(5-methyl-1,2-oxazol-3-yl)urea (PubChem CID 47125586) has the molecular formula C10H15N3O2 and a molecular weight of 209.25 g/mol. Its IUPAC name is 1-(1-cyclopropylethyl)-3-(5-methyl-1,2-oxazol-3-yl)urea.
| Compound Name | 1-(1-cyclopropylethyl)-3-(5-methyl-1,2-oxazol-3-yl)urea |
|---|---|
| PubChem CID | 47125586 |
| Molecular Formula | C10H15N3O2 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 1-(1-cyclopropylethyl)-3-(5-methyl-1,2-oxazol-3-yl)urea |
| SMILES | Cc1cc(NC(=O)NC(C)C2CC2)no1 |
| InChI | InChI=1S/C10H15N3O2/c1-6-5-9(13-15-6)12-10(14)11-7(2)8-3-4-8/h5,7-8H,3-4H2,1-2H3,(H2,11,12,13,14) |
| InChIKey | FYYIOGLANUXDIY-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |