C17H29N3O2 — CID 108812118
1-cyclododecyl-3-(5-methyl-1,2-oxazol-3-yl)urea (PubChem CID 108812118) has the molecular formula C17H29N3O2 and a molecular weight of 307.44 g/mol. Its IUPAC name is 1-cyclododecyl-3-(5-methyl-1,2-oxazol-3-yl)urea.
| Compound Name | 1-cyclododecyl-3-(5-methyl-1,2-oxazol-3-yl)urea |
|---|---|
| PubChem CID | 108812118 |
| Molecular Formula | C17H29N3O2 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.23 |
| IUPAC Name | 1-cyclododecyl-3-(5-methyl-1,2-oxazol-3-yl)urea |
| SMILES | Cc1cc(NC(=O)NC2CCCCCCCCCCC2)no1 |
| InChI | InChI=1S/C17H29N3O2/c1-14-13-16(20-22-14)19-17(21)18-15-11-9-7-5-3-2-4-6-8-10-12-15/h13,15H,2-12H2,1H3,(H2,18,19,20,21) |
| InChIKey | MJZQXYCIGFTZKJ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |