C11H15N3O3 — CID 44996024
N-cyclopentyl-N'-(5-methyl-1,2-oxazol-3-yl)oxamide (PubChem CID 44996024) has the molecular formula C11H15N3O3 and a molecular weight of 237.26 g/mol. Its IUPAC name is N-cyclopentyl-N'-(5-methyl-1,2-oxazol-3-yl)oxamide.
| Compound Name | N-cyclopentyl-N'-(5-methyl-1,2-oxazol-3-yl)oxamide |
|---|---|
| PubChem CID | 44996024 |
| Molecular Formula | C11H15N3O3 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | N-cyclopentyl-N'-(5-methyl-1,2-oxazol-3-yl)oxamide |
| SMILES | Cc1cc(NC(=O)C(=O)NC2CCCC2)no1 |
| InChI | InChI=1S/C11H15N3O3/c1-7-6-9(14-17-7)13-11(16)10(15)12-8-4-2-3-5-8/h6,8H,2-5H2,1H3,(H,12,15)(H,13,14,16) |
| InChIKey | DNMHZBDLTIUERQ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|