C11H16N2O2S — CID 110865536
N-(5-methyl-1,2-oxazol-3-yl)-2-(thian-4-yl)acetamide (PubChem CID 110865536) has the molecular formula C11H16N2O2S and a molecular weight of 240.33 g/mol. Its IUPAC name is N-(5-methyl-1,2-oxazol-3-yl)-2-(thian-4-yl)acetamide.
| Compound Name | N-(5-methyl-1,2-oxazol-3-yl)-2-(thian-4-yl)acetamide |
|---|---|
| PubChem CID | 110865536 |
| Molecular Formula | C11H16N2O2S |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | N-(5-methyl-1,2-oxazol-3-yl)-2-(thian-4-yl)acetamide |
| SMILES | Cc1cc(NC(=O)CC2CCSCC2)no1 |
| InChI | InChI=1S/C11H16N2O2S/c1-8-6-10(13-15-8)12-11(14)7-9-2-4-16-5-3-9/h6,9H,2-5,7H2,1H3,(H,12,13,14) |
| InChIKey | PASXYSWKCINLMU-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |