C16H22N2O2 — CID 2874506
2-(1-adamantyl)-N-(5-methyl-1,2-oxazol-3-yl)acetamide (PubChem CID 2874506) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is 2-(1-adamantyl)-N-(5-methyl-1,2-oxazol-3-yl)acetamide.
| Compound Name | 2-(1-adamantyl)-N-(5-methyl-1,2-oxazol-3-yl)acetamide |
|---|---|
| PubChem CID | 2874506 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 2-(1-adamantyl)-N-(5-methyl-1,2-oxazol-3-yl)acetamide |
| SMILES | Cc1cc(NC(=O)CC23CC4CC(CC(C4)C2)C3)no1 |
| InChI | InChI=1S/C16H22N2O2/c1-10-2-14(18-20-10)17-15(19)9-16-6-11-3-12(7-16)5-13(4-11)8-16/h2,11-13H,3-9H2,1H3,(H,17,18,19) |
| InChIKey | KKMPIRLBLGKAIC-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |