C20H26INO — CID 2958689
2-(1-adamantyl)-N-(4-iodo-2,5-dimethylphenyl)acetamide (PubChem CID 2958689) has the molecular formula C20H26INO and a molecular weight of 423.34 g/mol. Its IUPAC name is 2-(1-adamantyl)-N-(4-iodo-2,5-dimethylphenyl)acetamide.
| Compound Name | 2-(1-adamantyl)-N-(4-iodo-2,5-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 2958689 |
| Molecular Formula | C20H26INO |
| Molecular Weight | 423.34 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | 2-(1-adamantyl)-N-(4-iodo-2,5-dimethylphenyl)acetamide |
| SMILES | Cc1cc(NC(=O)CC23CC4CC(CC(C4)C2)C3)c(C)cc1I |
| InChI | InChI=1S/C20H26INO/c1-12-4-18(13(2)3-17(12)21)22-19(23)11-20-8-14-5-15(9-20)7-16(6-14)10-20/h3-4,14-16H,5-11H2,1-2H3,(H,22,23) |
| InChIKey | KQKSJKJCJLJNNT-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.34 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|