C19H25NO2 — CID 3340169
2-(1-adamantyl)-N-(2-hydroxy-5-methylphenyl)acetamide (PubChem CID 3340169) has the molecular formula C19H25NO2 and a molecular weight of 299.41 g/mol. Its IUPAC name is 2-(1-adamantyl)-N-(2-hydroxy-5-methylphenyl)acetamide.
| Compound Name | 2-(1-adamantyl)-N-(2-hydroxy-5-methylphenyl)acetamide |
|---|---|
| PubChem CID | 3340169 |
| Molecular Formula | C19H25NO2 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | 2-(1-adamantyl)-N-(2-hydroxy-5-methylphenyl)acetamide |
| SMILES | Cc1ccc(O)c(NC(=O)CC23CC4CC(CC(C4)C2)C3)c1 |
| InChI | InChI=1S/C19H25NO2/c1-12-2-3-17(21)16(4-12)20-18(22)11-19-8-13-5-14(9-19)7-15(6-13)10-19/h2-4,13-15,21H,5-11H2,1H3,(H,20,22) |
| InChIKey | JSZLPRKBAWTBOK-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|