About 2-(1-adamantyl)-N-(2,6-dihydroxyphenyl)acetamide
2-(1-adamantyl)-N-(2,6-dihydroxyphenyl)acetamide (PubChem CID 139249629) has the molecular formula C18H23NO3
and a molecular weight of 301.39 g/mol. Its IUPAC name is 2-(1-adamantyl)-N-(2,6-dihydroxyphenyl)acetamide.
Molecular Properties
| Compound Name | 2-(1-adamantyl)-N-(2,6-dihydroxyphenyl)acetamide |
| PubChem CID | 139249629 |
| Molecular Formula | C18H23NO3 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | 2-(1-adamantyl)-N-(2,6-dihydroxyphenyl)acetamide |
| SMILES | O=C(CC12CC3CC(CC(C3)C1)C2)Nc1c(O)cccc1O |
| InChI | InChI=1S/C18H23NO3/c20-14-2-1-3-15(21)17(14)19-16(22)10-18-7-11-4-12(8-18)6-13(5-11)9-18/h1-3,11-13,20-21H,4-10H2,(H,19,22) |
| InChIKey | OELXNMXWQKRUJC-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-adamantyl)-N-(2,6-dihydroxyphenyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-adamantyl)-N-(2,6-dihydroxyphenyl)acetamide?
The IUPAC name of 2-(1-adamantyl)-N-(2,6-dihydroxyphenyl)acetamide (CID 139249629) is 2-(1-adamantyl)-N-(2,6-dihydroxyphenyl)acetamide.
What is the SMILES notation for 2-(1-adamantyl)-N-(2,6-dihydroxyphenyl)acetamide?
The canonical SMILES for 2-(1-adamantyl)-N-(2,6-dihydroxyphenyl)acetamide is O=C(CC12CC3CC(CC(C3)C1)C2)Nc1c(O)cccc1O.
What is the InChIKey of 2-(1-adamantyl)-N-(2,6-dihydroxyphenyl)acetamide?
The InChIKey is OELXNMXWQKRUJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23NO3/c20-14-2-1-3-15(21)17(14)19-16(22)10-18-7-11-4-12(8-18)6-13(5-11)9-18/h1-3,11-13,20-21H,4-10H2,(H,19,22).
What are the key properties of 2-(1-adamantyl)-N-(2,6-dihydroxyphenyl)acetamide?
2-(1-adamantyl)-N-(2,6-dihydroxyphenyl)acetamide has a molecular weight of 301.39 g/mol, XLogP of 3.64, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-adamantyl)-N-(2,6-dihydroxyphenyl)acetamide is sourced from PubChem (CID 139249629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).