C18H23NO3 — CID 139249629
2-(1-adamantyl)-N-(2,6-dihydroxyphenyl)acetamide (PubChem CID 139249629) has the molecular formula C18H23NO3 and a molecular weight of 301.39 g/mol. Its IUPAC name is 2-(1-adamantyl)-N-(2,6-dihydroxyphenyl)acetamide.
| Compound Name | 2-(1-adamantyl)-N-(2,6-dihydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 139249629 |
| Molecular Formula | C18H23NO3 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | 2-(1-adamantyl)-N-(2,6-dihydroxyphenyl)acetamide |
| SMILES | O=C(CC12CC3CC(CC(C3)C1)C2)Nc1c(O)cccc1O |
| InChI | InChI=1S/C18H23NO3/c20-14-2-1-3-15(21)17(14)19-16(22)10-18-7-11-4-12(8-18)6-13(5-11)9-18/h1-3,11-13,20-21H,4-10H2,(H,19,22) |
| InChIKey | OELXNMXWQKRUJC-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|