C19H25NOS — CID 7734007
2-(1-adamantyl)-N-(3-methylsulfanylphenyl)acetamide (PubChem CID 7734007) has the molecular formula C19H25NOS and a molecular weight of 315.48 g/mol. Its IUPAC name is 2-(1-adamantyl)-N-(3-methylsulfanylphenyl)acetamide.
| Compound Name | 2-(1-adamantyl)-N-(3-methylsulfanylphenyl)acetamide |
|---|---|
| PubChem CID | 7734007 |
| Molecular Formula | C19H25NOS |
| Molecular Weight | 315.48 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | 2-(1-adamantyl)-N-(3-methylsulfanylphenyl)acetamide |
| SMILES | CSc1cccc(NC(=O)CC23CC4CC(CC(C4)C2)C3)c1 |
| InChI | InChI=1S/C19H25NOS/c1-22-17-4-2-3-16(8-17)20-18(21)12-19-9-13-5-14(10-19)7-15(6-13)11-19/h2-4,8,13-15H,5-7,9-12H2,1H3,(H,20,21) |
| InChIKey | ZWZZDVGGNPUVHG-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.48 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |