C22H30N2O3S — CID 4810691
2-(1-adamantyl)-N-(3-pyrrolidin-1-ylsulfonylphenyl)acetamide (PubChem CID 4810691) has the molecular formula C22H30N2O3S and a molecular weight of 402.56 g/mol. Its IUPAC name is 2-(1-adamantyl)-N-(3-pyrrolidin-1-ylsulfonylphenyl)acetamide.
| Compound Name | 2-(1-adamantyl)-N-(3-pyrrolidin-1-ylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 4810691 |
| Molecular Formula | C22H30N2O3S |
| Molecular Weight | 402.56 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | 2-(1-adamantyl)-N-(3-pyrrolidin-1-ylsulfonylphenyl)acetamide |
| SMILES | O=C(CC12CC3CC(CC(C3)C1)C2)Nc1cccc(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C22H30N2O3S/c25-21(15-22-12-16-8-17(13-22)10-18(9-16)14-22)23-19-4-3-5-20(11-19)28(26,27)24-6-1-2-7-24/h3-5,11,16-18H,1-2,6-10,12-15H2,(H,23,25) |
| InChIKey | BUQNFLWPZAUBRK-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.56 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |