C24H31ClN2O5S — CID 98592719
[2-oxo-2-(3-piperidin-1-ylsulfonylanilino)ethyl] (5S,7S)-3-chloroadamantane-1-carboxylate (PubChem CID 98592719) has the molecular formula C24H31ClN2O5S and a molecular weight of 495.04 g/mol. Its IUPAC name is [2-oxo-2-(3-piperidin-1-ylsulfonylanilino)ethyl] (5S,7S)-3-chloroadamantane-1-carboxylate.
| Compound Name | [2-oxo-2-(3-piperidin-1-ylsulfonylanilino)ethyl] (5S,7S)-3-chloroadamantane-1-carboxylate |
|---|---|
| PubChem CID | 98592719 |
| Molecular Formula | C24H31ClN2O5S |
| Molecular Weight | 495.04 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | [2-oxo-2-(3-piperidin-1-ylsulfonylanilino)ethyl] (5S,7S)-3-chloroadamantane-1-carboxylate |
| SMILES | O=C(COC(=O)C12C[C@@H]3C[C@H](CC(Cl)(C3)C1)C2)Nc1cccc(S(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C24H31ClN2O5S/c25-24-13-17-9-18(14-24)12-23(11-17,16-24)22(29)32-15-21(28)26-19-5-4-6-20(10-19)33(30,31)27-7-2-1-3-8-27/h4-6,10,17-18H,1-3,7-9,11-16H2,(H,26,28)/t17-,18-,23?,24?/m0/s1 |
| InChIKey | AXNOEXYLUADDFI-JSODFGIGSA-N |
| XLogP | 3.92 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.04 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|