C19H21Cl2NO3 — CID 7844088
[2-(2-chloroanilino)-2-oxoethyl] (5S,7R)-3-chloroadamantane-1-carboxylate (PubChem CID 7844088) has the molecular formula C19H21Cl2NO3 and a molecular weight of 382.29 g/mol. Its IUPAC name is [2-(2-chloroanilino)-2-oxoethyl] (5S,7R)-3-chloroadamantane-1-carboxylate.
| Compound Name | [2-(2-chloroanilino)-2-oxoethyl] (5S,7R)-3-chloroadamantane-1-carboxylate |
|---|---|
| PubChem CID | 7844088 |
| Molecular Formula | C19H21Cl2NO3 |
| Molecular Weight | 382.29 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | [2-(2-chloroanilino)-2-oxoethyl] (5S,7R)-3-chloroadamantane-1-carboxylate |
| SMILES | O=C(COC(=O)C12C[C@@H]3C[C@@H](CC(Cl)(C3)C1)C2)Nc1ccccc1Cl |
| InChI | InChI=1S/C19H21Cl2NO3/c20-14-3-1-2-4-15(14)22-16(23)10-25-17(24)18-6-12-5-13(7-18)9-19(21,8-12)11-18/h1-4,12-13H,5-11H2,(H,22,23)/t12-,13+,18?,19? |
| InChIKey | ZXCGSUWYYFPOFD-NFAYLAGKSA-N |
| XLogP | 4.40 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.29 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|