C19H22FNO3 — CID 5008790
[2-(2-fluoroanilino)-2-oxoethyl] adamantane-1-carboxylate (PubChem CID 5008790) has the molecular formula C19H22FNO3 and a molecular weight of 331.39 g/mol. Its IUPAC name is [2-(2-fluoroanilino)-2-oxoethyl] adamantane-1-carboxylate.
| Compound Name | [2-(2-fluoroanilino)-2-oxoethyl] adamantane-1-carboxylate |
|---|---|
| PubChem CID | 5008790 |
| Molecular Formula | C19H22FNO3 |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | [2-(2-fluoroanilino)-2-oxoethyl] adamantane-1-carboxylate |
| SMILES | O=C(COC(=O)C12CC3CC(CC(C3)C1)C2)Nc1ccccc1F |
| InChI | InChI=1S/C19H22FNO3/c20-15-3-1-2-4-16(15)21-17(22)11-24-18(23)19-8-12-5-13(9-19)7-14(6-12)10-19/h1-4,12-14H,5-11H2,(H,21,22) |
| InChIKey | IZESSEGNRMCURD-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |