C19H20BrF2NO3 — CID 55315856
[2-(2,4-difluoroanilino)-2-oxoethyl] 3-bromoadamantane-1-carboxylate (PubChem CID 55315856) has the molecular formula C19H20BrF2NO3 and a molecular weight of 428.27 g/mol. Its IUPAC name is [2-(2,4-difluoroanilino)-2-oxoethyl] 3-bromoadamantane-1-carboxylate.
| Compound Name | [2-(2,4-difluoroanilino)-2-oxoethyl] 3-bromoadamantane-1-carboxylate |
|---|---|
| PubChem CID | 55315856 |
| Molecular Formula | C19H20BrF2NO3 |
| Molecular Weight | 428.27 g/mol |
| Exact Mass | 427.06 |
| IUPAC Name | [2-(2,4-difluoroanilino)-2-oxoethyl] 3-bromoadamantane-1-carboxylate |
| SMILES | O=C(COC(=O)C12CC3CC(CC(Br)(C3)C1)C2)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C19H20BrF2NO3/c20-19-7-11-3-12(8-19)6-18(5-11,10-19)17(25)26-9-16(24)23-15-2-1-13(21)4-14(15)22/h1-2,4,11-12H,3,5-10H2,(H,23,24) |
| InChIKey | OCNNNPRLDNQUDB-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.27 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|