C19H19BrF2O3 — CID 8789092
[2-(2,5-difluorophenyl)-2-oxoethyl] (5S,7R)-3-bromoadamantane-1-carboxylate (PubChem CID 8789092) has the molecular formula C19H19BrF2O3 and a molecular weight of 413.26 g/mol. Its IUPAC name is [2-(2,5-difluorophenyl)-2-oxoethyl] (5S,7R)-3-bromoadamantane-1-carboxylate.
| Compound Name | [2-(2,5-difluorophenyl)-2-oxoethyl] (5S,7R)-3-bromoadamantane-1-carboxylate |
|---|---|
| PubChem CID | 8789092 |
| Molecular Formula | C19H19BrF2O3 |
| Molecular Weight | 413.26 g/mol |
| Exact Mass | 412.05 |
| IUPAC Name | [2-(2,5-difluorophenyl)-2-oxoethyl] (5S,7R)-3-bromoadamantane-1-carboxylate |
| SMILES | O=C(COC(=O)C12C[C@@H]3C[C@@H](CC(Br)(C3)C1)C2)c1cc(F)ccc1F |
| InChI | InChI=1S/C19H19BrF2O3/c20-19-7-11-3-12(8-19)6-18(5-11,10-19)17(24)25-9-16(23)14-4-13(21)1-2-15(14)22/h1-2,4,11-12H,3,5-10H2/t11-,12+,18?,19? |
| InChIKey | LIEZFPXNLONZFZ-ORMMXULVSA-N |
| XLogP | 4.42 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.26 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|