C24H30BrFN2O3 — CID 98328385
[2-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]-2-oxoethyl] (5R,7R)-3-bromoadamantane-1-carboxylate (PubChem CID 98328385) has the molecular formula C24H30BrFN2O3 and a molecular weight of 493.42 g/mol. Its IUPAC name is [2-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]-2-oxoethyl] (5R,7R)-3-bromoadamantane-1-carboxylate.
| Compound Name | [2-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]-2-oxoethyl] (5R,7R)-3-bromoadamantane-1-carboxylate |
|---|---|
| PubChem CID | 98328385 |
| Molecular Formula | C24H30BrFN2O3 |
| Molecular Weight | 493.42 g/mol |
| Exact Mass | 492.14 |
| IUPAC Name | [2-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]-2-oxoethyl] (5R,7R)-3-bromoadamantane-1-carboxylate |
| SMILES | O=C(COC(=O)C12C[C@H]3C[C@@H](CC(Br)(C3)C1)C2)N1CCN(Cc2ccccc2F)CC1 |
| InChI | InChI=1S/C24H30BrFN2O3/c25-24-12-17-9-18(13-24)11-23(10-17,16-24)22(30)31-15-21(29)28-7-5-27(6-8-28)14-19-3-1-2-4-20(19)26/h1-4,17-18H,5-16H2/t17-,18-,23?,24?/m1/s1 |
| InChIKey | AXCXTVGSQGGFLT-RDNZODCXSA-N |
| XLogP | 3.75 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.42 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|