C19H23BrFNO — CID 102603623
3-bromo-N-[2-(2-fluorophenyl)ethyl]adamantane-1-carboxamide (PubChem CID 102603623) has the molecular formula C19H23BrFNO and a molecular weight of 380.30 g/mol. Its IUPAC name is 3-bromo-N-[2-(2-fluorophenyl)ethyl]adamantane-1-carboxamide.
| Compound Name | 3-bromo-N-[2-(2-fluorophenyl)ethyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 102603623 |
| Molecular Formula | C19H23BrFNO |
| Molecular Weight | 380.30 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | 3-bromo-N-[2-(2-fluorophenyl)ethyl]adamantane-1-carboxamide |
| SMILES | O=C(NCCc1ccccc1F)C12CC3CC(CC(Br)(C3)C1)C2 |
| InChI | InChI=1S/C19H23BrFNO/c20-19-10-13-7-14(11-19)9-18(8-13,12-19)17(23)22-6-5-15-3-1-2-4-16(15)21/h1-4,13-14H,5-12H2,(H,22,23) |
| InChIKey | YJJDTLFQNVWAIZ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.30 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|