C24H28N2O — CID 39898183
(5S,7R)-3-phenyl-N-(2-pyridin-2-ylethyl)adamantane-1-carboxamide (PubChem CID 39898183) has the molecular formula C24H28N2O and a molecular weight of 360.50 g/mol. Its IUPAC name is (5S,7R)-3-phenyl-N-(2-pyridin-2-ylethyl)adamantane-1-carboxamide.
| Compound Name | (5S,7R)-3-phenyl-N-(2-pyridin-2-ylethyl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 39898183 |
| Molecular Formula | C24H28N2O |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | (5S,7R)-3-phenyl-N-(2-pyridin-2-ylethyl)adamantane-1-carboxamide |
| SMILES | O=C(NCCc1ccccn1)C12C[C@H]3C[C@@H](C1)CC(c1ccccc1)(C3)C2 |
| InChI | InChI=1S/C24H28N2O/c27-22(26-11-9-21-8-4-5-10-25-21)24-15-18-12-19(16-24)14-23(13-18,17-24)20-6-2-1-3-7-20/h1-8,10,18-19H,9,11-17H2,(H,26,27)/t18-,19+,23?,24? |
| InChIKey | FYNKPUZLXHQREH-LHHMWQFHSA-N |
| XLogP | 4.28 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |