C20H25NO — CID 98185678
(5R,7R)-3-phenyl-N-prop-2-enyladamantane-1-carboxamide (PubChem CID 98185678) has the molecular formula C20H25NO and a molecular weight of 295.43 g/mol. Its IUPAC name is (5R,7R)-3-phenyl-N-prop-2-enyladamantane-1-carboxamide.
| Compound Name | (5R,7R)-3-phenyl-N-prop-2-enyladamantane-1-carboxamide |
|---|---|
| PubChem CID | 98185678 |
| Molecular Formula | C20H25NO |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | (5R,7R)-3-phenyl-N-prop-2-enyladamantane-1-carboxamide |
| SMILES | C=CCNC(=O)C12C[C@@H]3C[C@@H](C1)CC(c1ccccc1)(C3)C2 |
| InChI | InChI=1S/C20H25NO/c1-2-8-21-18(22)20-12-15-9-16(13-20)11-19(10-15,14-20)17-6-4-3-5-7-17/h2-7,15-16H,1,8-14H2,(H,21,22)/t15-,16-,19?,20?/m1/s1 |
| InChIKey | VNGAZHYLRZZOQZ-JZFKGDSASA-N |
| XLogP | 3.83 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|