C22H25NOS — CID 52990919
3-phenyl-N-(thiophen-2-ylmethyl)adamantane-1-carboxamide (PubChem CID 52990919) has the molecular formula C22H25NOS and a molecular weight of 351.51 g/mol. Its IUPAC name is 3-phenyl-N-(thiophen-2-ylmethyl)adamantane-1-carboxamide.
| Compound Name | 3-phenyl-N-(thiophen-2-ylmethyl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 52990919 |
| Molecular Formula | C22H25NOS |
| Molecular Weight | 351.51 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | 3-phenyl-N-(thiophen-2-ylmethyl)adamantane-1-carboxamide |
| SMILES | O=C(NCc1cccs1)C12CC3CC(C1)CC(c1ccccc1)(C3)C2 |
| InChI | InChI=1S/C22H25NOS/c24-20(23-14-19-7-4-8-25-19)22-12-16-9-17(13-22)11-21(10-16,15-22)18-5-2-1-3-6-18/h1-8,16-17H,9-15H2,(H,23,24) |
| InChIKey | MAYLLHRPGIBTNJ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.51 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |