C16H21NOS — CID 2805256
N-(thiophen-2-ylmethyl)adamantane-1-carboxamide (PubChem CID 2805256) has the molecular formula C16H21NOS and a molecular weight of 275.42 g/mol. Its IUPAC name is N-(thiophen-2-ylmethyl)adamantane-1-carboxamide.
| Compound Name | N-(thiophen-2-ylmethyl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 2805256 |
| Molecular Formula | C16H21NOS |
| Molecular Weight | 275.42 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | N-(thiophen-2-ylmethyl)adamantane-1-carboxamide |
| SMILES | O=C(NCc1cccs1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C16H21NOS/c18-15(17-10-14-2-1-3-19-14)16-7-11-4-12(8-16)6-13(5-11)9-16/h1-3,11-13H,4-10H2,(H,17,18) |
| InChIKey | WRKJLJSHAQOMAK-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.42 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |