C20H28N2O2S2 — CID 18116583
N-[2-oxo-2-[2-(thiophen-2-ylmethylsulfanyl)ethylamino]ethyl]adamantane-1-carboxamide (PubChem CID 18116583) has the molecular formula C20H28N2O2S2 and a molecular weight of 392.59 g/mol. Its IUPAC name is N-[2-oxo-2-[2-(thiophen-2-ylmethylsulfanyl)ethylamino]ethyl]adamantane-1-carboxamide.
| Compound Name | N-[2-oxo-2-[2-(thiophen-2-ylmethylsulfanyl)ethylamino]ethyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 18116583 |
| Molecular Formula | C20H28N2O2S2 |
| Molecular Weight | 392.59 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | N-[2-oxo-2-[2-(thiophen-2-ylmethylsulfanyl)ethylamino]ethyl]adamantane-1-carboxamide |
| SMILES | O=C(CNC(=O)C12CC3CC(CC(C3)C1)C2)NCCSCc1cccs1 |
| InChI | InChI=1S/C20H28N2O2S2/c23-18(21-3-5-25-13-17-2-1-4-26-17)12-22-19(24)20-9-14-6-15(10-20)8-16(7-14)11-20/h1-2,4,14-16H,3,5-13H2,(H,21,23)(H,22,24) |
| InChIKey | JLZHAIOJJXTDOY-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.59 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|