C22H31N3O2S — CID 31328827
N-[2-oxo-2-[4-(thiophen-2-ylmethyl)piperazin-1-yl]ethyl]adamantane-1-carboxamide (PubChem CID 31328827) has the molecular formula C22H31N3O2S and a molecular weight of 401.58 g/mol. Its IUPAC name is N-[2-oxo-2-[4-(thiophen-2-ylmethyl)piperazin-1-yl]ethyl]adamantane-1-carboxamide.
| Compound Name | N-[2-oxo-2-[4-(thiophen-2-ylmethyl)piperazin-1-yl]ethyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 31328827 |
| Molecular Formula | C22H31N3O2S |
| Molecular Weight | 401.58 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | N-[2-oxo-2-[4-(thiophen-2-ylmethyl)piperazin-1-yl]ethyl]adamantane-1-carboxamide |
| SMILES | O=C(CNC(=O)C12CC3CC(CC(C3)C1)C2)N1CCN(Cc2cccs2)CC1 |
| InChI | InChI=1S/C22H31N3O2S/c26-20(25-5-3-24(4-6-25)15-19-2-1-7-28-19)14-23-21(27)22-11-16-8-17(12-22)10-18(9-16)13-22/h1-2,7,16-18H,3-6,8-15H2,(H,23,27) |
| InChIKey | SVFLZHWDUBETJU-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.58 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |