C11H16N2OS2 — CID 146037585
2-sulfanyl-1-[4-(thiophen-2-ylmethyl)piperazin-1-yl]ethanone (PubChem CID 146037585) has the molecular formula C11H16N2OS2 and a molecular weight of 256.40 g/mol. Its IUPAC name is 2-sulfanyl-1-[4-(thiophen-2-ylmethyl)piperazin-1-yl]ethanone.
| Compound Name | 2-sulfanyl-1-[4-(thiophen-2-ylmethyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 146037585 |
| Molecular Formula | C11H16N2OS2 |
| Molecular Weight | 256.40 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | 2-sulfanyl-1-[4-(thiophen-2-ylmethyl)piperazin-1-yl]ethanone |
| SMILES | O=C(CS)N1CCN(Cc2cccs2)CC1 |
| InChI | InChI=1S/C11H16N2OS2/c14-11(9-15)13-5-3-12(4-6-13)8-10-2-1-7-16-10/h1-2,7,15H,3-6,8-9H2 |
| InChIKey | KJAKUCOOVXYEIO-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 23.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.40 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|