C17H27N3OS — CID 78808495
1-(azepan-1-yl)-2-[4-(thiophen-2-ylmethyl)piperazin-1-yl]ethanone (PubChem CID 78808495) has the molecular formula C17H27N3OS and a molecular weight of 321.49 g/mol. Its IUPAC name is 1-(azepan-1-yl)-2-[4-(thiophen-2-ylmethyl)piperazin-1-yl]ethanone.
| Compound Name | 1-(azepan-1-yl)-2-[4-(thiophen-2-ylmethyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 78808495 |
| Molecular Formula | C17H27N3OS |
| Molecular Weight | 321.49 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | 1-(azepan-1-yl)-2-[4-(thiophen-2-ylmethyl)piperazin-1-yl]ethanone |
| SMILES | O=C(CN1CCN(Cc2cccs2)CC1)N1CCCCCC1 |
| InChI | InChI=1S/C17H27N3OS/c21-17(20-7-3-1-2-4-8-20)15-19-11-9-18(10-12-19)14-16-6-5-13-22-16/h5-6,13H,1-4,7-12,14-15H2 |
| InChIKey | VNDDXSXQTUTPLS-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.49 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |