C19H29ClN3O- — CID 53350851
1-(azepan-1-yl)-2-(4-benzylpiperazin-1-yl)ethanone chloride (PubChem CID 53350851) has the molecular formula C19H29ClN3O- and a molecular weight of 350.91 g/mol. Its IUPAC name is 1-(azepan-1-yl)-2-(4-benzylpiperazin-1-yl)ethanone chloride.
| Compound Name | 1-(azepan-1-yl)-2-(4-benzylpiperazin-1-yl)ethanone chloride |
|---|---|
| PubChem CID | 53350851 |
| Molecular Formula | C19H29ClN3O- |
| Molecular Weight | 350.91 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | 1-(azepan-1-yl)-2-(4-benzylpiperazin-1-yl)ethanone chloride |
| SMILES | O=C(CN1CCN(Cc2ccccc2)CC1)N1CCCCCC1.[Cl-] |
| InChI | InChI=1S/C19H29N3O.ClH/c23-19(22-10-6-1-2-7-11-22)17-21-14-12-20(13-15-21)16-18-8-4-3-5-9-18;/h3-5,8-9H,1-2,6-7,10-17H2;1H/p-1 |
| InChIKey | DVPHGVJJWGDUFU-UHFFFAOYSA-M |
| XLogP | -0.79 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.91 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |