C21H28N6O2 — CID 39487776
2-[4-(1-benzyltriazole-4-carbonyl)piperazin-1-yl]-1-piperidin-1-ylethanone (PubChem CID 39487776) has the molecular formula C21H28N6O2 and a molecular weight of 396.50 g/mol. Its IUPAC name is 2-[4-(1-benzyltriazole-4-carbonyl)piperazin-1-yl]-1-piperidin-1-ylethanone.
| Compound Name | 2-[4-(1-benzyltriazole-4-carbonyl)piperazin-1-yl]-1-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 39487776 |
| Molecular Formula | C21H28N6O2 |
| Molecular Weight | 396.50 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | 2-[4-(1-benzyltriazole-4-carbonyl)piperazin-1-yl]-1-piperidin-1-ylethanone |
| SMILES | O=C(CN1CCN(C(=O)c2cn(Cc3ccccc3)nn2)CC1)N1CCCCC1 |
| InChI | InChI=1S/C21H28N6O2/c28-20(25-9-5-2-6-10-25)17-24-11-13-26(14-12-24)21(29)19-16-27(23-22-19)15-18-7-3-1-4-8-18/h1,3-4,7-8,16H,2,5-6,9-15,17H2 |
| InChIKey | AFOAITDXMQDHBY-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 74.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.50 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |