C20H21N5O3S — CID 31769999
[4-(benzenesulfonyl)piperazin-1-yl]-(1-benzyltriazol-4-yl)methanone (PubChem CID 31769999) has the molecular formula C20H21N5O3S and a molecular weight of 411.49 g/mol. Its IUPAC name is [4-(benzenesulfonyl)piperazin-1-yl]-(1-benzyltriazol-4-yl)methanone.
| Compound Name | [4-(benzenesulfonyl)piperazin-1-yl]-(1-benzyltriazol-4-yl)methanone |
|---|---|
| PubChem CID | 31769999 |
| Molecular Formula | C20H21N5O3S |
| Molecular Weight | 411.49 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | [4-(benzenesulfonyl)piperazin-1-yl]-(1-benzyltriazol-4-yl)methanone |
| SMILES | O=C(c1cn(Cc2ccccc2)nn1)N1CCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C20H21N5O3S/c26-20(19-16-24(22-21-19)15-17-7-3-1-4-8-17)23-11-13-25(14-12-23)29(27,28)18-9-5-2-6-10-18/h1-10,16H,11-15H2 |
| InChIKey | DWPXXDORKBTIGW-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 88.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.49 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |