C29H34N4O3S — CID 43922265
[4-[[4-(benzenesulfonyl)piperazin-1-yl]methyl]phenyl]-(4-benzylpiperazin-1-yl)methanone (PubChem CID 43922265) has the molecular formula C29H34N4O3S and a molecular weight of 518.68 g/mol. Its IUPAC name is [4-[[4-(benzenesulfonyl)piperazin-1-yl]methyl]phenyl]-(4-benzylpiperazin-1-yl)methanone.
| Compound Name | [4-[[4-(benzenesulfonyl)piperazin-1-yl]methyl]phenyl]-(4-benzylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 43922265 |
| Molecular Formula | C29H34N4O3S |
| Molecular Weight | 518.68 g/mol |
| Exact Mass | 518.24 |
| IUPAC Name | [4-[[4-(benzenesulfonyl)piperazin-1-yl]methyl]phenyl]-(4-benzylpiperazin-1-yl)methanone |
| SMILES | O=C(c1ccc(CN2CCN(S(=O)(=O)c3ccccc3)CC2)cc1)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C29H34N4O3S/c34-29(32-19-15-30(16-20-32)23-25-7-3-1-4-8-25)27-13-11-26(12-14-27)24-31-17-21-33(22-18-31)37(35,36)28-9-5-2-6-10-28/h1-14H,15-24H2 |
| InChIKey | RICPYNCSDPEOPO-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 64.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.68 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |