C19H30N4O2S — CID 30740454
(2S)-2-[4-(2-oxo-2-piperidin-1-ylethyl)piperazin-1-yl]-N-(thiophen-2-ylmethyl)propanamide (PubChem CID 30740454) has the molecular formula C19H30N4O2S and a molecular weight of 378.54 g/mol. Its IUPAC name is (2S)-2-[4-(2-oxo-2-piperidin-1-ylethyl)piperazin-1-yl]-N-(thiophen-2-ylmethyl)propanamide.
| Compound Name | (2S)-2-[4-(2-oxo-2-piperidin-1-ylethyl)piperazin-1-yl]-N-(thiophen-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 30740454 |
| Molecular Formula | C19H30N4O2S |
| Molecular Weight | 378.54 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | (2S)-2-[4-(2-oxo-2-piperidin-1-ylethyl)piperazin-1-yl]-N-(thiophen-2-ylmethyl)propanamide |
| SMILES | C[C@@H](C(=O)NCc1cccs1)N1CCN(CC(=O)N2CCCCC2)CC1 |
| InChI | InChI=1S/C19H30N4O2S/c1-16(19(25)20-14-17-6-5-13-26-17)22-11-9-21(10-12-22)15-18(24)23-7-3-2-4-8-23/h5-6,13,16H,2-4,7-12,14-15H2,1H3,(H,20,25)/t16-/m0/s1 |
| InChIKey | BJPKLETYVQWGKS-INIZCTEOSA-N |
| XLogP | 1.38 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.54 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |