C18H28N4O2S — CID 86912732
4-(2-oxo-2-piperidin-1-ylethyl)-N-(2-thiophen-2-ylethyl)piperazine-1-carboxamide (PubChem CID 86912732) has the molecular formula C18H28N4O2S and a molecular weight of 364.52 g/mol. Its IUPAC name is 4-(2-oxo-2-piperidin-1-ylethyl)-N-(2-thiophen-2-ylethyl)piperazine-1-carboxamide.
| Compound Name | 4-(2-oxo-2-piperidin-1-ylethyl)-N-(2-thiophen-2-ylethyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 86912732 |
| Molecular Formula | C18H28N4O2S |
| Molecular Weight | 364.52 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 4-(2-oxo-2-piperidin-1-ylethyl)-N-(2-thiophen-2-ylethyl)piperazine-1-carboxamide |
| SMILES | O=C(CN1CCN(C(=O)NCCc2cccs2)CC1)N1CCCCC1 |
| InChI | InChI=1S/C18H28N4O2S/c23-17(21-8-2-1-3-9-21)15-20-10-12-22(13-11-20)18(24)19-7-6-16-5-4-14-25-16/h4-5,14H,1-3,6-13,15H2,(H,19,24) |
| InChIKey | PGKARMVHSFZCLW-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.52 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |