C21H35IN6O2S — CID 110038196
N,N-dimethyl-2-[[[4-(2-oxo-2-pyrrolidin-1-ylethyl)piperazin-1-yl]-(2-thiophen-2-ylethylamino)methylidene]amino]acetamide;hydroiodide (PubChem CID 110038196) has the molecular formula C21H35IN6O2S and a molecular weight of 562.52 g/mol. Its IUPAC name is N,N-dimethyl-2-[[[4-(2-oxo-2-pyrrolidin-1-ylethyl)piperazin-1-yl]-(2-thiophen-2-ylethylamino)methylidene]amino]acetamide;hydroiodide.
| Compound Name | N,N-dimethyl-2-[[[4-(2-oxo-2-pyrrolidin-1-ylethyl)piperazin-1-yl]-(2-thiophen-2-ylethylamino)methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 110038196 |
| Molecular Formula | C21H35IN6O2S |
| Molecular Weight | 562.52 g/mol |
| Exact Mass | 562.16 |
| IUPAC Name | N,N-dimethyl-2-[[[4-(2-oxo-2-pyrrolidin-1-ylethyl)piperazin-1-yl]-(2-thiophen-2-ylethylamino)methylidene]amino]acetamide;hydroiodide |
| SMILES | CN(C)C(=O)C/N=C(\NCCc1cccs1)N1CCN(CC(=O)N2CCCC2)CC1.I |
| InChI | InChI=1S/C21H34N6O2S.HI/c1-24(2)19(28)16-23-21(22-8-7-18-6-5-15-30-18)27-13-11-25(12-14-27)17-20(29)26-9-3-4-10-26;/h5-6,15H,3-4,7-14,16-17H2,1-2H3,(H,22,23);1H |
| InChIKey | BWILTWZPWGRFDM-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 71.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.52 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|