C19H28IN5OS2 — CID 110046594
N,N-dimethyl-2-[[(2-thiophen-2-ylethylamino)-(4-thiophen-2-ylpiperazin-1-yl)methylidene]amino]acetamide;hydroiodide (PubChem CID 110046594) has the molecular formula C19H28IN5OS2 and a molecular weight of 533.51 g/mol. Its IUPAC name is N,N-dimethyl-2-[[(2-thiophen-2-ylethylamino)-(4-thiophen-2-ylpiperazin-1-yl)methylidene]amino]acetamide;hydroiodide.
| Compound Name | N,N-dimethyl-2-[[(2-thiophen-2-ylethylamino)-(4-thiophen-2-ylpiperazin-1-yl)methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 110046594 |
| Molecular Formula | C19H28IN5OS2 |
| Molecular Weight | 533.51 g/mol |
| Exact Mass | 533.08 |
| IUPAC Name | N,N-dimethyl-2-[[(2-thiophen-2-ylethylamino)-(4-thiophen-2-ylpiperazin-1-yl)methylidene]amino]acetamide;hydroiodide |
| SMILES | CN(C)C(=O)C/N=C(\NCCc1cccs1)N1CCN(c2cccs2)CC1.I |
| InChI | InChI=1S/C19H27N5OS2.HI/c1-22(2)17(25)15-21-19(20-8-7-16-5-3-13-26-16)24-11-9-23(10-12-24)18-6-4-14-27-18;/h3-6,13-14H,7-12,15H2,1-2H3,(H,20,21);1H |
| InChIKey | VBUBMHFOIOLZJX-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 51.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.51 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|