C20H30IN5OS2 — CID 110045684
N,N-dimethyl-2-[[(2-thiophen-2-ylethylamino)-[(1-thiophen-2-ylpiperidin-4-yl)amino]methylidene]amino]acetamide;hydroiodide (PubChem CID 110045684) has the molecular formula C20H30IN5OS2 and a molecular weight of 547.53 g/mol. Its IUPAC name is N,N-dimethyl-2-[[(2-thiophen-2-ylethylamino)-[(1-thiophen-2-ylpiperidin-4-yl)amino]methylidene]amino]acetamide;hydroiodide.
| Compound Name | N,N-dimethyl-2-[[(2-thiophen-2-ylethylamino)-[(1-thiophen-2-ylpiperidin-4-yl)amino]methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 110045684 |
| Molecular Formula | C20H30IN5OS2 |
| Molecular Weight | 547.53 g/mol |
| Exact Mass | 547.09 |
| IUPAC Name | N,N-dimethyl-2-[[(2-thiophen-2-ylethylamino)-[(1-thiophen-2-ylpiperidin-4-yl)amino]methylidene]amino]acetamide;hydroiodide |
| SMILES | CN(C)C(=O)C/N=C(\NCCc1cccs1)NC1CCN(c2cccs2)CC1.I |
| InChI | InChI=1S/C20H29N5OS2.HI/c1-24(2)18(26)15-22-20(21-10-7-17-5-3-13-27-17)23-16-8-11-25(12-9-16)19-6-4-14-28-19;/h3-6,13-14,16H,7-12,15H2,1-2H3,(H2,21,22,23);1H |
| InChIKey | QGMHPGSEPGWFNM-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.53 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|