C21H31IN6OS — CID 110040544
N,N-dimethyl-2-[[[[1-(5-methyl-2-pyridinyl)piperidin-4-yl]amino]-(thiophen-2-ylmethylamino)methylidene]amino]acetamide;hydroiodide (PubChem CID 110040544) has the molecular formula C21H31IN6OS and a molecular weight of 542.49 g/mol. Its IUPAC name is N,N-dimethyl-2-[[[[1-(5-methyl-2-pyridinyl)piperidin-4-yl]amino]-(thiophen-2-ylmethylamino)methylidene]amino]acetamide;hydroiodide.
| Compound Name | N,N-dimethyl-2-[[[[1-(5-methyl-2-pyridinyl)piperidin-4-yl]amino]-(thiophen-2-ylmethylamino)methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 110040544 |
| Molecular Formula | C21H31IN6OS |
| Molecular Weight | 542.49 g/mol |
| Exact Mass | 542.13 |
| IUPAC Name | N,N-dimethyl-2-[[[[1-(5-methyl-2-pyridinyl)piperidin-4-yl]amino]-(thiophen-2-ylmethylamino)methylidene]amino]acetamide;hydroiodide |
| SMILES | Cc1ccc(N2CCC(N/C(=N/CC(=O)N(C)C)NCc3cccs3)CC2)nc1.I |
| InChI | InChI=1S/C21H30N6OS.HI/c1-16-6-7-19(22-13-16)27-10-8-17(9-11-27)25-21(24-15-20(28)26(2)3)23-14-18-5-4-12-29-18;/h4-7,12-13,17H,8-11,14-15H2,1-3H3,(H2,23,24,25);1H |
| InChIKey | WICQAYKPMFUSDB-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 72.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.49 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|