C22H36N6O2 — CID 110040531
N,N-dimethyl-2-[[[[1-(5-methyl-2-pyridinyl)piperidin-4-yl]amino]-(oxan-2-ylmethylamino)methylidene]amino]acetamide (PubChem CID 110040531) has the molecular formula C22H36N6O2 and a molecular weight of 416.57 g/mol. Its IUPAC name is N,N-dimethyl-2-[[[[1-(5-methyl-2-pyridinyl)piperidin-4-yl]amino]-(oxan-2-ylmethylamino)methylidene]amino]acetamide.
| Compound Name | N,N-dimethyl-2-[[[[1-(5-methyl-2-pyridinyl)piperidin-4-yl]amino]-(oxan-2-ylmethylamino)methylidene]amino]acetamide |
|---|---|
| PubChem CID | 110040531 |
| Molecular Formula | C22H36N6O2 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.29 |
| IUPAC Name | N,N-dimethyl-2-[[[[1-(5-methyl-2-pyridinyl)piperidin-4-yl]amino]-(oxan-2-ylmethylamino)methylidene]amino]acetamide |
| SMILES | Cc1ccc(N2CCC(N/C(=N/CC(=O)N(C)C)NCC3CCCCO3)CC2)nc1 |
| InChI | InChI=1S/C22H36N6O2/c1-17-7-8-20(23-14-17)28-11-9-18(10-12-28)26-22(25-16-21(29)27(2)3)24-15-19-6-4-5-13-30-19/h7-8,14,18-19H,4-6,9-13,15-16H2,1-3H3,(H2,24,25,26) |
| InChIKey | HIYQERLZMOCZBR-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 82.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|