C21H32ClFIN5O2 — CID 110049763
2-[[[[1-(3-chloro-4-fluorophenyl)pyrrolidin-3-yl]amino]-(oxan-2-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 110049763) has the molecular formula C21H32ClFIN5O2 and a molecular weight of 567.88 g/mol. Its IUPAC name is 2-[[[[1-(3-chloro-4-fluorophenyl)pyrrolidin-3-yl]amino]-(oxan-2-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[[[1-(3-chloro-4-fluorophenyl)pyrrolidin-3-yl]amino]-(oxan-2-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 110049763 |
| Molecular Formula | C21H32ClFIN5O2 |
| Molecular Weight | 567.88 g/mol |
| Exact Mass | 567.13 |
| IUPAC Name | 2-[[[[1-(3-chloro-4-fluorophenyl)pyrrolidin-3-yl]amino]-(oxan-2-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CN(C)C(=O)C/N=C(\NCC1CCCCO1)NC1CCN(c2ccc(F)c(Cl)c2)C1.I |
| InChI | InChI=1S/C21H31ClFN5O2.HI/c1-27(2)20(29)13-25-21(24-12-17-5-3-4-10-30-17)26-15-8-9-28(14-15)16-6-7-19(23)18(22)11-16;/h6-7,11,15,17H,3-5,8-10,12-14H2,1-2H3,(H2,24,25,26);1H |
| InChIKey | RQPLBBQUKZMTBU-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.88 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|