C21H27ClFN5O2 — CID 110061382
2-[[[[1-(3-chloro-4-fluorophenyl)pyrrolidin-3-yl]amino]-[2-(furan-2-yl)ethylamino]methylidene]amino]-N,N-dimethylacetamide (PubChem CID 110061382) has the molecular formula C21H27ClFN5O2 and a molecular weight of 435.93 g/mol. Its IUPAC name is 2-[[[[1-(3-chloro-4-fluorophenyl)pyrrolidin-3-yl]amino]-[2-(furan-2-yl)ethylamino]methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[[[1-(3-chloro-4-fluorophenyl)pyrrolidin-3-yl]amino]-[2-(furan-2-yl)ethylamino]methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110061382 |
| Molecular Formula | C21H27ClFN5O2 |
| Molecular Weight | 435.93 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | 2-[[[[1-(3-chloro-4-fluorophenyl)pyrrolidin-3-yl]amino]-[2-(furan-2-yl)ethylamino]methylidene]amino]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)C/N=C(\NCCc1ccco1)NC1CCN(c2ccc(F)c(Cl)c2)C1 |
| InChI | InChI=1S/C21H27ClFN5O2/c1-27(2)20(29)13-25-21(24-9-7-17-4-3-11-30-17)26-15-8-10-28(14-15)16-5-6-19(23)18(22)12-16/h3-6,11-12,15H,7-10,13-14H2,1-2H3,(H2,24,25,26) |
| InChIKey | ZBEWKHIVPBFLGA-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 73.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.93 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|