C19H34IN5O2 — CID 111907088
2-[[[2-(furan-2-yl)ethylamino]-[(1-propan-2-ylpiperidin-4-yl)amino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 111907088) has the molecular formula C19H34IN5O2 and a molecular weight of 491.42 g/mol. Its IUPAC name is 2-[[[2-(furan-2-yl)ethylamino]-[(1-propan-2-ylpiperidin-4-yl)amino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[[2-(furan-2-yl)ethylamino]-[(1-propan-2-ylpiperidin-4-yl)amino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111907088 |
| Molecular Formula | C19H34IN5O2 |
| Molecular Weight | 491.42 g/mol |
| Exact Mass | 491.18 |
| IUPAC Name | 2-[[[2-(furan-2-yl)ethylamino]-[(1-propan-2-ylpiperidin-4-yl)amino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CC(C)N1CCC(N/C(=N/CC(=O)N(C)C)NCCc2ccco2)CC1.I |
| InChI | InChI=1S/C19H33N5O2.HI/c1-15(2)24-11-8-16(9-12-24)22-19(21-14-18(25)23(3)4)20-10-7-17-6-5-13-26-17;/h5-6,13,15-16H,7-12,14H2,1-4H3,(H2,20,21,22);1H |
| InChIKey | DDFFEXGKNNALLU-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 73.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.42 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|