C20H31N7O2 — CID 110055840
2-[[[2-(furan-2-yl)ethylamino]-[(2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)amino]methylidene]amino]-N,N-dimethylacetamide (PubChem CID 110055840) has the molecular formula C20H31N7O2 and a molecular weight of 401.52 g/mol. Its IUPAC name is 2-[[[2-(furan-2-yl)ethylamino]-[(2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)amino]methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[[2-(furan-2-yl)ethylamino]-[(2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)amino]methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110055840 |
| Molecular Formula | C20H31N7O2 |
| Molecular Weight | 401.52 g/mol |
| Exact Mass | 401.25 |
| IUPAC Name | 2-[[[2-(furan-2-yl)ethylamino]-[(2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)amino]methylidene]amino]-N,N-dimethylacetamide |
| SMILES | CC(C)c1nc2n(n1)CC(N/C(=N/CC(=O)N(C)C)NCCc1ccco1)CC2 |
| InChI | InChI=1S/C20H31N7O2/c1-14(2)19-24-17-8-7-15(13-27(17)25-19)23-20(22-12-18(28)26(3)4)21-10-9-16-6-5-11-29-16/h5-6,11,14-15H,7-10,12-13H2,1-4H3,(H2,21,22,23) |
| InChIKey | XHRCKWYMCJTXPO-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 100.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.52 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|