C22H34IN7O — CID 110041117
N,N-dimethyl-2-[[(1-phenylethylamino)-[(2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)amino]methylidene]amino]acetamide;hydroiodide (PubChem CID 110041117) has the molecular formula C22H34IN7O and a molecular weight of 539.47 g/mol. Its IUPAC name is N,N-dimethyl-2-[[(1-phenylethylamino)-[(2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)amino]methylidene]amino]acetamide;hydroiodide.
| Compound Name | N,N-dimethyl-2-[[(1-phenylethylamino)-[(2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)amino]methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 110041117 |
| Molecular Formula | C22H34IN7O |
| Molecular Weight | 539.47 g/mol |
| Exact Mass | 539.19 |
| IUPAC Name | N,N-dimethyl-2-[[(1-phenylethylamino)-[(2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)amino]methylidene]amino]acetamide;hydroiodide |
| SMILES | CC(C)c1nc2n(n1)CC(N/C(=N/CC(=O)N(C)C)NC(C)c1ccccc1)CC2.I |
| InChI | InChI=1S/C22H33N7O.HI/c1-15(2)21-26-19-12-11-18(14-29(19)27-21)25-22(23-13-20(30)28(4)5)24-16(3)17-9-7-6-8-10-17;/h6-10,15-16,18H,11-14H2,1-5H3,(H2,23,24,25);1H |
| InChIKey | VYKXSYVQXUGLCC-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 87.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.47 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|