C20H33IN4OS — CID 110041791
N,N-dimethyl-2-[[[(3-methylsulfanylcyclohexyl)amino]-(1-phenylethylamino)methylidene]amino]acetamide;hydroiodide (PubChem CID 110041791) has the molecular formula C20H33IN4OS and a molecular weight of 504.48 g/mol. Its IUPAC name is N,N-dimethyl-2-[[[(3-methylsulfanylcyclohexyl)amino]-(1-phenylethylamino)methylidene]amino]acetamide;hydroiodide.
| Compound Name | N,N-dimethyl-2-[[[(3-methylsulfanylcyclohexyl)amino]-(1-phenylethylamino)methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 110041791 |
| Molecular Formula | C20H33IN4OS |
| Molecular Weight | 504.48 g/mol |
| Exact Mass | 504.14 |
| IUPAC Name | N,N-dimethyl-2-[[[(3-methylsulfanylcyclohexyl)amino]-(1-phenylethylamino)methylidene]amino]acetamide;hydroiodide |
| SMILES | CSC1CCCC(N/C(=N/CC(=O)N(C)C)NC(C)c2ccccc2)C1.I |
| InChI | InChI=1S/C20H32N4OS.HI/c1-15(16-9-6-5-7-10-16)22-20(21-14-19(25)24(2)3)23-17-11-8-12-18(13-17)26-4;/h5-7,9-10,15,17-18H,8,11-14H2,1-4H3,(H2,21,22,23);1H |
| InChIKey | JRRXKLUEBWXVNG-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.48 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|