C19H27N7O — CID 110040982
N,N-dimethyl-2-[[(1-phenylethylamino)-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-ylamino)methylidene]amino]acetamide (PubChem CID 110040982) has the molecular formula C19H27N7O and a molecular weight of 369.47 g/mol. Its IUPAC name is N,N-dimethyl-2-[[(1-phenylethylamino)-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-ylamino)methylidene]amino]acetamide.
| Compound Name | N,N-dimethyl-2-[[(1-phenylethylamino)-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-ylamino)methylidene]amino]acetamide |
|---|---|
| PubChem CID | 110040982 |
| Molecular Formula | C19H27N7O |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | N,N-dimethyl-2-[[(1-phenylethylamino)-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-ylamino)methylidene]amino]acetamide |
| SMILES | CC(N/C(=N\CC(=O)N(C)C)NC1CCc2ncnn2C1)c1ccccc1 |
| InChI | InChI=1S/C19H27N7O/c1-14(15-7-5-4-6-8-15)23-19(20-11-18(27)25(2)3)24-16-9-10-17-21-13-22-26(17)12-16/h4-8,13-14,16H,9-12H2,1-3H3,(H2,20,23,24) |
| InChIKey | PMBSQGDSENQXOI-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 87.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|