C19H28IN7O — CID 110041001
N,N-dimethyl-2-[[(2-phenylethylamino)-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-ylamino)methylidene]amino]acetamide;hydroiodide (PubChem CID 110041001) has the molecular formula C19H28IN7O and a molecular weight of 497.39 g/mol. Its IUPAC name is N,N-dimethyl-2-[[(2-phenylethylamino)-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-ylamino)methylidene]amino]acetamide;hydroiodide.
| Compound Name | N,N-dimethyl-2-[[(2-phenylethylamino)-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-ylamino)methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 110041001 |
| Molecular Formula | C19H28IN7O |
| Molecular Weight | 497.39 g/mol |
| Exact Mass | 497.14 |
| IUPAC Name | N,N-dimethyl-2-[[(2-phenylethylamino)-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-ylamino)methylidene]amino]acetamide;hydroiodide |
| SMILES | CN(C)C(=O)C/N=C(\NCCc1ccccc1)NC1CCc2ncnn2C1.I |
| InChI | InChI=1S/C19H27N7O.HI/c1-25(2)18(27)12-21-19(20-11-10-15-6-4-3-5-7-15)24-16-8-9-17-22-14-23-26(17)13-16;/h3-7,14,16H,8-13H2,1-2H3,(H2,20,21,24);1H |
| InChIKey | HDRZCLBLXFBJKP-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 87.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.39 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|