C20H32IN5O2 — CID 110047505
N,N-dimethyl-2-[[(2-phenylethylamino)-[(1-propanoylpyrrolidin-3-yl)amino]methylidene]amino]acetamide;hydroiodide (PubChem CID 110047505) has the molecular formula C20H32IN5O2 and a molecular weight of 501.41 g/mol. Its IUPAC name is N,N-dimethyl-2-[[(2-phenylethylamino)-[(1-propanoylpyrrolidin-3-yl)amino]methylidene]amino]acetamide;hydroiodide.
| Compound Name | N,N-dimethyl-2-[[(2-phenylethylamino)-[(1-propanoylpyrrolidin-3-yl)amino]methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 110047505 |
| Molecular Formula | C20H32IN5O2 |
| Molecular Weight | 501.41 g/mol |
| Exact Mass | 501.16 |
| IUPAC Name | N,N-dimethyl-2-[[(2-phenylethylamino)-[(1-propanoylpyrrolidin-3-yl)amino]methylidene]amino]acetamide;hydroiodide |
| SMILES | CCC(=O)N1CCC(N/C(=N/CC(=O)N(C)C)NCCc2ccccc2)C1.I |
| InChI | InChI=1S/C20H31N5O2.HI/c1-4-18(26)25-13-11-17(15-25)23-20(22-14-19(27)24(2)3)21-12-10-16-8-6-5-7-9-16;/h5-9,17H,4,10-15H2,1-3H3,(H2,21,22,23);1H |
| InChIKey | QCWDXYKBLSKKQC-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.41 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|