C21H33ClIN5O3 — CID 111862492
ethyl 4-[[N-[2-(3-chlorophenyl)ethyl]-N'-[2-(dimethylamino)-2-oxoethyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide (PubChem CID 111862492) has the molecular formula C21H33ClIN5O3 and a molecular weight of 565.88 g/mol. Its IUPAC name is ethyl 4-[[N-[2-(3-chlorophenyl)ethyl]-N'-[2-(dimethylamino)-2-oxoethyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[[N-[2-(3-chlorophenyl)ethyl]-N'-[2-(dimethylamino)-2-oxoethyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111862492 |
| Molecular Formula | C21H33ClIN5O3 |
| Molecular Weight | 565.88 g/mol |
| Exact Mass | 565.13 |
| IUPAC Name | ethyl 4-[[N-[2-(3-chlorophenyl)ethyl]-N'-[2-(dimethylamino)-2-oxoethyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
| SMILES | CCOC(=O)N1CCC(N/C(=N/CC(=O)N(C)C)NCCc2cccc(Cl)c2)CC1.I |
| InChI | InChI=1S/C21H32ClN5O3.HI/c1-4-30-21(29)27-12-9-18(10-13-27)25-20(24-15-19(28)26(2)3)23-11-8-16-6-5-7-17(22)14-16;/h5-7,14,18H,4,8-13,15H2,1-3H3,(H2,23,24,25);1H |
| InChIKey | QEMOZOOLVBJFQB-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.88 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|