C16H32IN5O3 — CID 111776995
ethyl 4-[[N'-[2-(dimethylamino)-2-oxoethyl]-N-propylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide (PubChem CID 111776995) has the molecular formula C16H32IN5O3 and a molecular weight of 469.37 g/mol. Its IUPAC name is ethyl 4-[[N'-[2-(dimethylamino)-2-oxoethyl]-N-propylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[[N'-[2-(dimethylamino)-2-oxoethyl]-N-propylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111776995 |
| Molecular Formula | C16H32IN5O3 |
| Molecular Weight | 469.37 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | ethyl 4-[[N'-[2-(dimethylamino)-2-oxoethyl]-N-propylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
| SMILES | CCCN/C(=N\CC(=O)N(C)C)NC1CCN(C(=O)OCC)CC1.I |
| InChI | InChI=1S/C16H31N5O3.HI/c1-5-9-17-15(18-12-14(22)20(3)4)19-13-7-10-21(11-8-13)16(23)24-6-2;/h13H,5-12H2,1-4H3,(H2,17,18,19);1H |
| InChIKey | IGGWIRQBQHIKQS-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.37 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|